C15H17ClN3O4P — CID 22459906
[5-[1-(4-aminobutyl)-6-chlorobenzimidazol-2-yl]furan-2-yl]phosphonic acid (PubChem CID 22459906) has the molecular formula C15H17ClN3O4P and a molecular weight of 369.75 g/mol. Its IUPAC name is [5-[1-(4-aminobutyl)-6-chlorobenzimidazol-2-yl]furan-2-yl]phosphonic acid.
| Compound Name | [5-[1-(4-aminobutyl)-6-chlorobenzimidazol-2-yl]furan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 22459906 |
| Molecular Formula | C15H17ClN3O4P |
| Molecular Weight | 369.75 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | [5-[1-(4-aminobutyl)-6-chlorobenzimidazol-2-yl]furan-2-yl]phosphonic acid |
| SMILES | NCCCCn1c(-c2ccc(P(=O)(O)O)o2)nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H17ClN3O4P/c16-10-3-4-11-12(9-10)19(8-2-1-7-17)15(18-11)13-5-6-14(23-13)24(20,21)22/h3-6,9H,1-2,7-8,17H2,(H2,20,21,22) |
| InChIKey | JYVJDEMZXPAPRS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.75 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|