C20H18Cl4N4 — CID 91737844
5,6-dichloro-1-[4-(5,6-dichloro-2-methylbenzimidazol-1-yl)butyl]-2-methylbenzimidazole (PubChem CID 91737844) has the molecular formula C20H18Cl4N4 and a molecular weight of 456.20 g/mol. Its IUPAC name is 5,6-dichloro-1-[4-(5,6-dichloro-2-methylbenzimidazol-1-yl)butyl]-2-methylbenzimidazole.
| Compound Name | 5,6-dichloro-1-[4-(5,6-dichloro-2-methylbenzimidazol-1-yl)butyl]-2-methylbenzimidazole |
|---|---|
| PubChem CID | 91737844 |
| Molecular Formula | C20H18Cl4N4 |
| Molecular Weight | 456.20 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | 5,6-dichloro-1-[4-(5,6-dichloro-2-methylbenzimidazol-1-yl)butyl]-2-methylbenzimidazole |
| SMILES | Cc1nc2cc(Cl)c(Cl)cc2n1CCCCn1c(C)nc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C20H18Cl4N4/c1-11-25-17-7-13(21)15(23)9-19(17)27(11)5-3-4-6-28-12(2)26-18-8-14(22)16(24)10-20(18)28/h7-10H,3-6H2,1-2H3 |
| InChIKey | HMHJBHPMSZNRHC-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.20 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|