C14H17N2NaO2 — CID 165382501
sodium 4-(2,5,6-trimethylbenzimidazol-1-yl)butanoate (PubChem CID 165382501) has the molecular formula C14H17N2NaO2 and a molecular weight of 268.29 g/mol. Its IUPAC name is sodium 4-(2,5,6-trimethylbenzimidazol-1-yl)butanoate.
| Compound Name | sodium 4-(2,5,6-trimethylbenzimidazol-1-yl)butanoate |
|---|---|
| PubChem CID | 165382501 |
| Molecular Formula | C14H17N2NaO2 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | sodium 4-(2,5,6-trimethylbenzimidazol-1-yl)butanoate |
| SMILES | Cc1cc2nc(C)n(CCCC(=O)[O-])c2cc1C.[Na+] |
| InChI | InChI=1S/C14H18N2O2.Na/c1-9-7-12-13(8-10(9)2)16(11(3)15-12)6-4-5-14(17)18;/h7-8H,4-6H2,1-3H3,(H,17,18);/q;+1/p-1 |
| InChIKey | HMKHMNZHZONBPP-UHFFFAOYSA-M |
| XLogP | -1.50 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |