C15H21N3O2 — CID 82359658
4-[2-(ethylamino)-5,6-dimethylbenzimidazol-1-yl]butanoic acid (PubChem CID 82359658) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-[2-(ethylamino)-5,6-dimethylbenzimidazol-1-yl]butanoic acid.
| Compound Name | 4-[2-(ethylamino)-5,6-dimethylbenzimidazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 82359658 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 4-[2-(ethylamino)-5,6-dimethylbenzimidazol-1-yl]butanoic acid |
| SMILES | CCNc1nc2cc(C)c(C)cc2n1CCCC(=O)O |
| InChI | InChI=1S/C15H21N3O2/c1-4-16-15-17-12-8-10(2)11(3)9-13(12)18(15)7-5-6-14(19)20/h8-9H,4-7H2,1-3H3,(H,16,17)(H,19,20) |
| InChIKey | UTJTXBUIGMTQRW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |