C14H19N3O2 — CID 657047
5-(2-amino-5,6-dimethylbenzimidazol-1-yl)pentanoic acid (PubChem CID 657047) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 5-(2-amino-5,6-dimethylbenzimidazol-1-yl)pentanoic acid.
| Compound Name | 5-(2-amino-5,6-dimethylbenzimidazol-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 657047 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 5-(2-amino-5,6-dimethylbenzimidazol-1-yl)pentanoic acid |
| SMILES | Cc1cc2nc(N)n(CCCCC(=O)O)c2cc1C |
| InChI | InChI=1S/C14H19N3O2/c1-9-7-11-12(8-10(9)2)17(14(15)16-11)6-4-3-5-13(18)19/h7-8H,3-6H2,1-2H3,(H2,15,16)(H,18,19) |
| InChIKey | ONFQTORHROMJSV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|