C15H19LiN2O2 — CID 165382455
lithium 5-(2,4,6-trimethylbenzimidazol-1-yl)pentanoate (PubChem CID 165382455) has the molecular formula C15H19LiN2O2 and a molecular weight of 266.27 g/mol. Its IUPAC name is lithium 5-(2,4,6-trimethylbenzimidazol-1-yl)pentanoate.
| Compound Name | lithium 5-(2,4,6-trimethylbenzimidazol-1-yl)pentanoate |
|---|---|
| PubChem CID | 165382455 |
| Molecular Formula | C15H19LiN2O2 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | lithium 5-(2,4,6-trimethylbenzimidazol-1-yl)pentanoate |
| SMILES | Cc1cc(C)c2nc(C)n(CCCCC(=O)[O-])c2c1.[Li+] |
| InChI | InChI=1S/C15H20N2O2.Li/c1-10-8-11(2)15-13(9-10)17(12(3)16-15)7-5-4-6-14(18)19;/h8-9H,4-7H2,1-3H3,(H,18,19);/q;+1/p-1 |
| InChIKey | NFSZNTKRIIMVGV-UHFFFAOYSA-M |
| XLogP | -1.11 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|