C15H20KN2OPV — CID 167643136
potassium;1-methanidylphosphanyl-4-(2,4,6-trimethylbenzimidazol-1-yl)butan-1-one;vanadium (PubChem CID 167643136) has the molecular formula C15H20KN2OPV and a molecular weight of 365.35 g/mol. Its IUPAC name is potassium;1-methanidylphosphanyl-4-(2,4,6-trimethylbenzimidazol-1-yl)butan-1-one;vanadium.
| Compound Name | potassium;1-methanidylphosphanyl-4-(2,4,6-trimethylbenzimidazol-1-yl)butan-1-one;vanadium |
|---|---|
| PubChem CID | 167643136 |
| Molecular Formula | C15H20KN2OPV |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | potassium;1-methanidylphosphanyl-4-(2,4,6-trimethylbenzimidazol-1-yl)butan-1-one;vanadium |
| SMILES | [CH2-]PC(=O)CCCn1c(C)nc2c(C)cc(C)cc21.[K+].[V] |
| InChI | InChI=1S/C15H20N2OP.K.V/c1-10-8-11(2)15-13(9-10)17(12(3)16-15)7-5-6-14(18)19-4;;/h8-9,19H,4-7H2,1-3H3;;/q-1;+1; |
| InChIKey | WAUUIUFYBOXYCF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|