C15H21Cl2N3 — CID 94749196
4-[5,6-dichloro-2-(2-methylpropyl)benzimidazol-1-yl]butan-1-amine (PubChem CID 94749196) has the molecular formula C15H21Cl2N3 and a molecular weight of 314.26 g/mol. Its IUPAC name is 4-[5,6-dichloro-2-(2-methylpropyl)benzimidazol-1-yl]butan-1-amine.
| Compound Name | 4-[5,6-dichloro-2-(2-methylpropyl)benzimidazol-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 94749196 |
| Molecular Formula | C15H21Cl2N3 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 4-[5,6-dichloro-2-(2-methylpropyl)benzimidazol-1-yl]butan-1-amine |
| SMILES | CC(C)Cc1nc2cc(Cl)c(Cl)cc2n1CCCCN |
| InChI | InChI=1S/C15H21Cl2N3/c1-10(2)7-15-19-13-8-11(16)12(17)9-14(13)20(15)6-4-3-5-18/h8-10H,3-7,18H2,1-2H3 |
| InChIKey | ATFJELZAVHJIPO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|