C20H22Cl2N4O2 — CID 158964291
3-[[1-(5-aminopentyl)-5,6-dichlorobenzimidazol-2-yl]methyl]-N-hydroxybenzamide (PubChem CID 158964291) has the molecular formula C20H22Cl2N4O2 and a molecular weight of 421.33 g/mol. Its IUPAC name is 3-[[1-(5-aminopentyl)-5,6-dichlorobenzimidazol-2-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 3-[[1-(5-aminopentyl)-5,6-dichlorobenzimidazol-2-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 158964291 |
| Molecular Formula | C20H22Cl2N4O2 |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 3-[[1-(5-aminopentyl)-5,6-dichlorobenzimidazol-2-yl]methyl]-N-hydroxybenzamide |
| SMILES | NCCCCCn1c(Cc2cccc(C(=O)NO)c2)nc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C20H22Cl2N4O2/c21-15-11-17-18(12-16(15)22)26(8-3-1-2-7-23)19(24-17)10-13-5-4-6-14(9-13)20(27)25-28/h4-6,9,11-12,28H,1-3,7-8,10,23H2,(H,25,27) |
| InChIKey | NHDBCKJTZBDQQO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|