C19H21N3O3 — CID 11382208
N-hydroxy-1-(3-hydroxypropyl)-2-(2-phenylethyl)benzimidazole-5-carboxamide (PubChem CID 11382208) has the molecular formula C19H21N3O3 and a molecular weight of 339.39 g/mol. Its IUPAC name is N-hydroxy-1-(3-hydroxypropyl)-2-(2-phenylethyl)benzimidazole-5-carboxamide.
| Compound Name | N-hydroxy-1-(3-hydroxypropyl)-2-(2-phenylethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 11382208 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-hydroxy-1-(3-hydroxypropyl)-2-(2-phenylethyl)benzimidazole-5-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)nc(CCc1ccccc1)n2CCCO |
| InChI | InChI=1S/C19H21N3O3/c23-12-4-11-22-17-9-8-15(19(24)21-25)13-16(17)20-18(22)10-7-14-5-2-1-3-6-14/h1-3,5-6,8-9,13,23,25H,4,7,10-12H2,(H,21,24) |
| InChIKey | GVDINOVHHJJJDD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|