C19H19N3O3 — CID 71815611
N-hydroxy-1-methyl-2-oxo-3-(3-phenylpropyl)quinoxaline-6-carboxamide (PubChem CID 71815611) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-hydroxy-1-methyl-2-oxo-3-(3-phenylpropyl)quinoxaline-6-carboxamide.
| Compound Name | N-hydroxy-1-methyl-2-oxo-3-(3-phenylpropyl)quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 71815611 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N-hydroxy-1-methyl-2-oxo-3-(3-phenylpropyl)quinoxaline-6-carboxamide |
| SMILES | Cn1c(=O)c(CCCc2ccccc2)nc2cc(C(=O)NO)ccc21 |
| InChI | InChI=1S/C19H19N3O3/c1-22-17-11-10-14(18(23)21-25)12-16(17)20-15(19(22)24)9-5-8-13-6-3-2-4-7-13/h2-4,6-7,10-12,25H,5,8-9H2,1H3,(H,21,23) |
| InChIKey | ZEAPXOZRCLIYNT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|