C11H10Cl3N3O2 — CID 83203162
2-[5,6-dichloro-2-(chloromethyl)benzimidazol-1-yl]ethyl carbamate (PubChem CID 83203162) has the molecular formula C11H10Cl3N3O2 and a molecular weight of 322.58 g/mol. Its IUPAC name is 2-[5,6-dichloro-2-(chloromethyl)benzimidazol-1-yl]ethyl carbamate.
| Compound Name | 2-[5,6-dichloro-2-(chloromethyl)benzimidazol-1-yl]ethyl carbamate |
|---|---|
| PubChem CID | 83203162 |
| Molecular Formula | C11H10Cl3N3O2 |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 320.98 |
| IUPAC Name | 2-[5,6-dichloro-2-(chloromethyl)benzimidazol-1-yl]ethyl carbamate |
| SMILES | NC(=O)OCCn1c(CCl)nc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C11H10Cl3N3O2/c12-5-10-16-8-3-6(13)7(14)4-9(8)17(10)1-2-19-11(15)18/h3-4H,1-2,5H2,(H2,15,18) |
| InChIKey | DGNPMSUIHPPNNO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|