C12H10Cl3F3N2 — CID 115521028
5,6-dichloro-2-(chloromethyl)-1-(4,4,4-trifluorobutyl)benzimidazole (PubChem CID 115521028) has the molecular formula C12H10Cl3F3N2 and a molecular weight of 345.58 g/mol. Its IUPAC name is 5,6-dichloro-2-(chloromethyl)-1-(4,4,4-trifluorobutyl)benzimidazole.
| Compound Name | 5,6-dichloro-2-(chloromethyl)-1-(4,4,4-trifluorobutyl)benzimidazole |
|---|---|
| PubChem CID | 115521028 |
| Molecular Formula | C12H10Cl3F3N2 |
| Molecular Weight | 345.58 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 5,6-dichloro-2-(chloromethyl)-1-(4,4,4-trifluorobutyl)benzimidazole |
| SMILES | FC(F)(F)CCCn1c(CCl)nc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C12H10Cl3F3N2/c13-6-11-19-9-4-7(14)8(15)5-10(9)20(11)3-1-2-12(16,17)18/h4-5H,1-3,6H2 |
| InChIKey | KTPFMUAMUJEWGB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.58 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|