C11H8ClF4IN2 — CID 66094885
2-(chloromethyl)-6-fluoro-5-iodo-1-(3,3,3-trifluoropropyl)benzimidazole (PubChem CID 66094885) has the molecular formula C11H8ClF4IN2 and a molecular weight of 406.55 g/mol. Its IUPAC name is 2-(chloromethyl)-6-fluoro-5-iodo-1-(3,3,3-trifluoropropyl)benzimidazole.
| Compound Name | 2-(chloromethyl)-6-fluoro-5-iodo-1-(3,3,3-trifluoropropyl)benzimidazole |
|---|---|
| PubChem CID | 66094885 |
| Molecular Formula | C11H8ClF4IN2 |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 405.94 |
| IUPAC Name | 2-(chloromethyl)-6-fluoro-5-iodo-1-(3,3,3-trifluoropropyl)benzimidazole |
| SMILES | Fc1cc2c(cc1I)nc(CCl)n2CCC(F)(F)F |
| InChI | InChI=1S/C11H8ClF4IN2/c12-5-10-18-8-4-7(17)6(13)3-9(8)19(10)2-1-11(14,15)16/h3-4H,1-2,5H2 |
| InChIKey | YJAUADLOWYUXOJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|