C10H8F4IN3 — CID 66100609
6-fluoro-5-iodo-1-(3,3,3-trifluoropropyl)benzimidazol-2-amine (PubChem CID 66100609) has the molecular formula C10H8F4IN3 and a molecular weight of 373.09 g/mol. Its IUPAC name is 6-fluoro-5-iodo-1-(3,3,3-trifluoropropyl)benzimidazol-2-amine.
| Compound Name | 6-fluoro-5-iodo-1-(3,3,3-trifluoropropyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 66100609 |
| Molecular Formula | C10H8F4IN3 |
| Molecular Weight | 373.09 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | 6-fluoro-5-iodo-1-(3,3,3-trifluoropropyl)benzimidazol-2-amine |
| SMILES | Nc1nc2cc(I)c(F)cc2n1CCC(F)(F)F |
| InChI | InChI=1S/C10H8F4IN3/c11-5-3-8-7(4-6(5)15)17-9(16)18(8)2-1-10(12,13)14/h3-4H,1-2H2,(H2,16,17) |
| InChIKey | GPIPVTIVCOAFGK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.09 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|