C15H12F2IN3 — CID 66099992
6-fluoro-1-[2-(4-fluorophenyl)ethyl]-5-iodobenzimidazol-2-amine (PubChem CID 66099992) has the molecular formula C15H12F2IN3 and a molecular weight of 399.18 g/mol. Its IUPAC name is 6-fluoro-1-[2-(4-fluorophenyl)ethyl]-5-iodobenzimidazol-2-amine.
| Compound Name | 6-fluoro-1-[2-(4-fluorophenyl)ethyl]-5-iodobenzimidazol-2-amine |
|---|---|
| PubChem CID | 66099992 |
| Molecular Formula | C15H12F2IN3 |
| Molecular Weight | 399.18 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | 6-fluoro-1-[2-(4-fluorophenyl)ethyl]-5-iodobenzimidazol-2-amine |
| SMILES | Nc1nc2cc(I)c(F)cc2n1CCc1ccc(F)cc1 |
| InChI | InChI=1S/C15H12F2IN3/c16-10-3-1-9(2-4-10)5-6-21-14-7-11(17)12(18)8-13(14)20-15(21)19/h1-4,7-8H,5-6H2,(H2,19,20) |
| InChIKey | HEMPOASJOIYFRV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.18 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|