C12H12ClF4N3 — CID 115520923
5-chloro-6-fluoro-1-(5,5,5-trifluoropentyl)benzimidazol-2-amine (PubChem CID 115520923) has the molecular formula C12H12ClF4N3 and a molecular weight of 309.69 g/mol. Its IUPAC name is 5-chloro-6-fluoro-1-(5,5,5-trifluoropentyl)benzimidazol-2-amine.
| Compound Name | 5-chloro-6-fluoro-1-(5,5,5-trifluoropentyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 115520923 |
| Molecular Formula | C12H12ClF4N3 |
| Molecular Weight | 309.69 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 5-chloro-6-fluoro-1-(5,5,5-trifluoropentyl)benzimidazol-2-amine |
| SMILES | Nc1nc2cc(Cl)c(F)cc2n1CCCCC(F)(F)F |
| InChI | InChI=1S/C12H12ClF4N3/c13-7-5-9-10(6-8(7)14)20(11(18)19-9)4-2-1-3-12(15,16)17/h5-6H,1-4H2,(H2,18,19) |
| InChIKey | LPLWOQWROUPZRI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.69 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|