C15H19ClFN3 — CID 66078119
5-chloro-1-(2-cyclohexylethyl)-6-fluorobenzimidazol-2-amine (PubChem CID 66078119) has the molecular formula C15H19ClFN3 and a molecular weight of 295.79 g/mol. Its IUPAC name is 5-chloro-1-(2-cyclohexylethyl)-6-fluorobenzimidazol-2-amine.
| Compound Name | 5-chloro-1-(2-cyclohexylethyl)-6-fluorobenzimidazol-2-amine |
|---|---|
| PubChem CID | 66078119 |
| Molecular Formula | C15H19ClFN3 |
| Molecular Weight | 295.79 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 5-chloro-1-(2-cyclohexylethyl)-6-fluorobenzimidazol-2-amine |
| SMILES | Nc1nc2cc(Cl)c(F)cc2n1CCC1CCCCC1 |
| InChI | InChI=1S/C15H19ClFN3/c16-11-8-13-14(9-12(11)17)20(15(18)19-13)7-6-10-4-2-1-3-5-10/h8-10H,1-7H2,(H2,18,19) |
| InChIKey | YYPRDOFWYQAXMD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.79 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |