C13H16ClFN4S — CID 106326375
5-chloro-6-fluoro-1-(2-thiomorpholin-4-ylethyl)benzimidazol-2-amine (PubChem CID 106326375) has the molecular formula C13H16ClFN4S and a molecular weight of 314.82 g/mol. Its IUPAC name is 5-chloro-6-fluoro-1-(2-thiomorpholin-4-ylethyl)benzimidazol-2-amine.
| Compound Name | 5-chloro-6-fluoro-1-(2-thiomorpholin-4-ylethyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 106326375 |
| Molecular Formula | C13H16ClFN4S |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 5-chloro-6-fluoro-1-(2-thiomorpholin-4-ylethyl)benzimidazol-2-amine |
| SMILES | Nc1nc2cc(Cl)c(F)cc2n1CCN1CCSCC1 |
| InChI | InChI=1S/C13H16ClFN4S/c14-9-7-11-12(8-10(9)15)19(13(16)17-11)2-1-18-3-5-20-6-4-18/h7-8H,1-6H2,(H2,16,17) |
| InChIKey | GTVGKHBUWPSLNK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |