C13H11ClFN3S — CID 66076958
5-chloro-6-fluoro-1-(2-thiophen-3-ylethyl)benzimidazol-2-amine (PubChem CID 66076958) has the molecular formula C13H11ClFN3S and a molecular weight of 295.77 g/mol. Its IUPAC name is 5-chloro-6-fluoro-1-(2-thiophen-3-ylethyl)benzimidazol-2-amine.
| Compound Name | 5-chloro-6-fluoro-1-(2-thiophen-3-ylethyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 66076958 |
| Molecular Formula | C13H11ClFN3S |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 5-chloro-6-fluoro-1-(2-thiophen-3-ylethyl)benzimidazol-2-amine |
| SMILES | Nc1nc2cc(Cl)c(F)cc2n1CCc1ccsc1 |
| InChI | InChI=1S/C13H11ClFN3S/c14-9-5-11-12(6-10(9)15)18(13(16)17-11)3-1-8-2-4-19-7-8/h2,4-7H,1,3H2,(H2,16,17) |
| InChIKey | RZYFYAARFFGMKB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |