C14H15Cl3N2 — CID 113479149
5,6-dichloro-2-(chloromethyl)-1-(2-cyclobutylethyl)benzimidazole (PubChem CID 113479149) has the molecular formula C14H15Cl3N2 and a molecular weight of 317.65 g/mol. Its IUPAC name is 5,6-dichloro-2-(chloromethyl)-1-(2-cyclobutylethyl)benzimidazole.
| Compound Name | 5,6-dichloro-2-(chloromethyl)-1-(2-cyclobutylethyl)benzimidazole |
|---|---|
| PubChem CID | 113479149 |
| Molecular Formula | C14H15Cl3N2 |
| Molecular Weight | 317.65 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 5,6-dichloro-2-(chloromethyl)-1-(2-cyclobutylethyl)benzimidazole |
| SMILES | ClCc1nc2cc(Cl)c(Cl)cc2n1CCC1CCC1 |
| InChI | InChI=1S/C14H15Cl3N2/c15-8-14-18-12-6-10(16)11(17)7-13(12)19(14)5-4-9-2-1-3-9/h6-7,9H,1-5,8H2 |
| InChIKey | RKEHZHWEKYXXDB-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.65 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|