C13H13BrClFN2 — CID 66088881
5-bromo-2-(chloromethyl)-1-(cyclobutylmethyl)-6-fluorobenzimidazole (PubChem CID 66088881) has the molecular formula C13H13BrClFN2 and a molecular weight of 331.62 g/mol. Its IUPAC name is 5-bromo-2-(chloromethyl)-1-(cyclobutylmethyl)-6-fluorobenzimidazole.
| Compound Name | 5-bromo-2-(chloromethyl)-1-(cyclobutylmethyl)-6-fluorobenzimidazole |
|---|---|
| PubChem CID | 66088881 |
| Molecular Formula | C13H13BrClFN2 |
| Molecular Weight | 331.62 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 5-bromo-2-(chloromethyl)-1-(cyclobutylmethyl)-6-fluorobenzimidazole |
| SMILES | Fc1cc2c(cc1Br)nc(CCl)n2CC1CCC1 |
| InChI | InChI=1S/C13H13BrClFN2/c14-9-4-11-12(5-10(9)16)18(13(6-15)17-11)7-8-2-1-3-8/h4-5,8H,1-3,6-7H2 |
| InChIKey | XSYIYFYNVJRHHC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.62 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|