C15H18BrClFN3 — CID 66086361
5-bromo-2-(chloromethyl)-6-fluoro-1-[(1-methylpiperidin-4-yl)methyl]benzimidazole (PubChem CID 66086361) has the molecular formula C15H18BrClFN3 and a molecular weight of 374.69 g/mol. Its IUPAC name is 5-bromo-2-(chloromethyl)-6-fluoro-1-[(1-methylpiperidin-4-yl)methyl]benzimidazole.
| Compound Name | 5-bromo-2-(chloromethyl)-6-fluoro-1-[(1-methylpiperidin-4-yl)methyl]benzimidazole |
|---|---|
| PubChem CID | 66086361 |
| Molecular Formula | C15H18BrClFN3 |
| Molecular Weight | 374.69 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 5-bromo-2-(chloromethyl)-6-fluoro-1-[(1-methylpiperidin-4-yl)methyl]benzimidazole |
| SMILES | CN1CCC(Cn2c(CCl)nc3cc(Br)c(F)cc32)CC1 |
| InChI | InChI=1S/C15H18BrClFN3/c1-20-4-2-10(3-5-20)9-21-14-7-12(18)11(16)6-13(14)19-15(21)8-17/h6-7,10H,2-5,8-9H2,1H3 |
| InChIKey | DUUADPXZXPPKRA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.69 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|