C13H13BrClFN2O2S — CID 66087321
3-[[5-bromo-2-(chloromethyl)-6-fluorobenzimidazol-1-yl]methyl]thiolane 1,1-dioxide (PubChem CID 66087321) has the molecular formula C13H13BrClFN2O2S and a molecular weight of 395.68 g/mol. Its IUPAC name is 3-[[5-bromo-2-(chloromethyl)-6-fluorobenzimidazol-1-yl]methyl]thiolane 1,1-dioxide.
| Compound Name | 3-[[5-bromo-2-(chloromethyl)-6-fluorobenzimidazol-1-yl]methyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 66087321 |
| Molecular Formula | C13H13BrClFN2O2S |
| Molecular Weight | 395.68 g/mol |
| Exact Mass | 393.96 |
| IUPAC Name | 3-[[5-bromo-2-(chloromethyl)-6-fluorobenzimidazol-1-yl]methyl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(Cn2c(CCl)nc3cc(Br)c(F)cc32)C1 |
| InChI | InChI=1S/C13H13BrClFN2O2S/c14-9-3-11-12(4-10(9)16)18(13(5-15)17-11)6-8-1-2-21(19,20)7-8/h3-4,8H,1-2,5-7H2 |
| InChIKey | NKNOHAONEPMPAS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.68 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|