C12H12BrFN2O2S2 — CID 116737668
5-bromo-3-[(1,1-dioxothiolan-3-yl)methyl]-6-fluoro-1H-benzimidazole-2-thione (PubChem CID 116737668) has the molecular formula C12H12BrFN2O2S2 and a molecular weight of 379.28 g/mol. Its IUPAC name is 5-bromo-3-[(1,1-dioxothiolan-3-yl)methyl]-6-fluoro-1H-benzimidazole-2-thione.
| Compound Name | 5-bromo-3-[(1,1-dioxothiolan-3-yl)methyl]-6-fluoro-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 116737668 |
| Molecular Formula | C12H12BrFN2O2S2 |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 377.95 |
| IUPAC Name | 5-bromo-3-[(1,1-dioxothiolan-3-yl)methyl]-6-fluoro-1H-benzimidazole-2-thione |
| SMILES | O=S1(=O)CCC(Cn2c(=S)[nH]c3cc(F)c(Br)cc32)C1 |
| InChI | InChI=1S/C12H12BrFN2O2S2/c13-8-3-11-10(4-9(8)14)15-12(19)16(11)5-7-1-2-20(17,18)6-7/h3-4,7H,1-2,5-6H2,(H,15,19) |
| InChIKey | YXDYJVVHLYABMF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|