C12H12FIN2OS — CID 66102138
5-fluoro-6-iodo-3-(oxolan-3-ylmethyl)-1H-benzimidazole-2-thione (PubChem CID 66102138) has the molecular formula C12H12FIN2OS and a molecular weight of 378.21 g/mol. Its IUPAC name is 5-fluoro-6-iodo-3-(oxolan-3-ylmethyl)-1H-benzimidazole-2-thione.
| Compound Name | 5-fluoro-6-iodo-3-(oxolan-3-ylmethyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 66102138 |
| Molecular Formula | C12H12FIN2OS |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | 5-fluoro-6-iodo-3-(oxolan-3-ylmethyl)-1H-benzimidazole-2-thione |
| SMILES | Fc1cc2c(cc1I)[nH]c(=S)n2CC1CCOC1 |
| InChI | InChI=1S/C12H12FIN2OS/c13-8-3-11-10(4-9(8)14)15-12(18)16(11)5-7-1-2-17-6-7/h3-4,7H,1-2,5-6H2,(H,15,18) |
| InChIKey | KWNVSGZCMRFSFX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|