C12H13IN2OS — CID 66081717
6-iodo-3-(oxolan-3-ylmethyl)-1H-benzimidazole-2-thione (PubChem CID 66081717) has the molecular formula C12H13IN2OS and a molecular weight of 360.22 g/mol. Its IUPAC name is 6-iodo-3-(oxolan-3-ylmethyl)-1H-benzimidazole-2-thione.
| Compound Name | 6-iodo-3-(oxolan-3-ylmethyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 66081717 |
| Molecular Formula | C12H13IN2OS |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | 6-iodo-3-(oxolan-3-ylmethyl)-1H-benzimidazole-2-thione |
| SMILES | S=c1[nH]c2cc(I)ccc2n1CC1CCOC1 |
| InChI | InChI=1S/C12H13IN2OS/c13-9-1-2-11-10(5-9)14-12(17)15(11)6-8-3-4-16-7-8/h1-2,5,8H,3-4,6-7H2,(H,14,17) |
| InChIKey | RYNZBQJTBNBCSR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|