C11H11FN2S — CID 43659824
3-(cyclopropylmethyl)-6-fluoro-1H-benzimidazole-2-thione (PubChem CID 43659824) has the molecular formula C11H11FN2S and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-(cyclopropylmethyl)-6-fluoro-1H-benzimidazole-2-thione.
| Compound Name | 3-(cyclopropylmethyl)-6-fluoro-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 43659824 |
| Molecular Formula | C11H11FN2S |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 3-(cyclopropylmethyl)-6-fluoro-1H-benzimidazole-2-thione |
| SMILES | Fc1ccc2c(c1)[nH]c(=S)n2CC1CC1 |
| InChI | InChI=1S/C11H11FN2S/c12-8-3-4-10-9(5-8)13-11(15)14(10)6-7-1-2-7/h3-5,7H,1-2,6H2,(H,13,15) |
| InChIKey | GXUIMYXMDHLNSA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|