C13H16N2O2S — CID 83008052
3-(cyclopropylmethyl)-5,6-dimethoxy-1H-benzimidazole-2-thione (PubChem CID 83008052) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 3-(cyclopropylmethyl)-5,6-dimethoxy-1H-benzimidazole-2-thione.
| Compound Name | 3-(cyclopropylmethyl)-5,6-dimethoxy-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 83008052 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 3-(cyclopropylmethyl)-5,6-dimethoxy-1H-benzimidazole-2-thione |
| SMILES | COc1cc2[nH]c(=S)n(CC3CC3)c2cc1OC |
| InChI | InChI=1S/C13H16N2O2S/c1-16-11-5-9-10(6-12(11)17-2)15(13(18)14-9)7-8-3-4-8/h5-6,8H,3-4,7H2,1-2H3,(H,14,18) |
| InChIKey | MFUQXNZEAJGTAI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|