C13H18N2O3 — CID 970962
N-(3,4-dimethoxyphenyl)pyrrolidine-1-carboxamide (PubChem CID 970962) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)pyrrolidine-1-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 970962 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)pyrrolidine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCCC2)cc1OC |
| InChI | InChI=1S/C13H18N2O3/c1-17-11-6-5-10(9-12(11)18-2)14-13(16)15-7-3-4-8-15/h5-6,9H,3-4,7-8H2,1-2H3,(H,14,16) |
| InChIKey | HADUQTYHPKJXOZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |