C14H9F3N2S — CID 63795001
3-[(2,5-difluorophenyl)methyl]-6-fluoro-1H-benzimidazole-2-thione (PubChem CID 63795001) has the molecular formula C14H9F3N2S and a molecular weight of 294.30 g/mol. Its IUPAC name is 3-[(2,5-difluorophenyl)methyl]-6-fluoro-1H-benzimidazole-2-thione.
| Compound Name | 3-[(2,5-difluorophenyl)methyl]-6-fluoro-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 63795001 |
| Molecular Formula | C14H9F3N2S |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 3-[(2,5-difluorophenyl)methyl]-6-fluoro-1H-benzimidazole-2-thione |
| SMILES | Fc1ccc(F)c(Cn2c(=S)[nH]c3cc(F)ccc32)c1 |
| InChI | InChI=1S/C14H9F3N2S/c15-9-1-3-11(17)8(5-9)7-19-13-4-2-10(16)6-12(13)18-14(19)20/h1-6H,7H2,(H,18,20) |
| InChIKey | GAXWDTQQPNWZSH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|