C9H9FN2S — CID 43660035
3-ethyl-6-fluoro-1H-benzimidazole-2-thione (PubChem CID 43660035) has the molecular formula C9H9FN2S and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-ethyl-6-fluoro-1H-benzimidazole-2-thione.
| Compound Name | 3-ethyl-6-fluoro-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 43660035 |
| Molecular Formula | C9H9FN2S |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 3-ethyl-6-fluoro-1H-benzimidazole-2-thione |
| SMILES | CCn1c(=S)[nH]c2cc(F)ccc21 |
| InChI | InChI=1S/C9H9FN2S/c1-2-12-8-4-3-6(10)5-7(8)11-9(12)13/h3-5H,2H2,1H3,(H,11,13) |
| InChIKey | UCERKYRHPVHRTD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|