C13H15IN2S2 — CID 113487852
6-iodo-3-(thian-4-ylmethyl)-1H-benzimidazole-2-thione (PubChem CID 113487852) has the molecular formula C13H15IN2S2 and a molecular weight of 390.32 g/mol. Its IUPAC name is 6-iodo-3-(thian-4-ylmethyl)-1H-benzimidazole-2-thione.
| Compound Name | 6-iodo-3-(thian-4-ylmethyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 113487852 |
| Molecular Formula | C13H15IN2S2 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | 6-iodo-3-(thian-4-ylmethyl)-1H-benzimidazole-2-thione |
| SMILES | S=c1[nH]c2cc(I)ccc2n1CC1CCSCC1 |
| InChI | InChI=1S/C13H15IN2S2/c14-10-1-2-12-11(7-10)15-13(17)16(12)8-9-3-5-18-6-4-9/h1-2,7,9H,3-6,8H2,(H,15,17) |
| InChIKey | QSPGQPWEXRDACQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|