C13H17IN2S — CID 66081336
3-(2,3-dimethylbutyl)-6-iodo-1H-benzimidazole-2-thione (PubChem CID 66081336) has the molecular formula C13H17IN2S and a molecular weight of 360.26 g/mol. Its IUPAC name is 3-(2,3-dimethylbutyl)-6-iodo-1H-benzimidazole-2-thione.
| Compound Name | 3-(2,3-dimethylbutyl)-6-iodo-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 66081336 |
| Molecular Formula | C13H17IN2S |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 3-(2,3-dimethylbutyl)-6-iodo-1H-benzimidazole-2-thione |
| SMILES | CC(C)C(C)Cn1c(=S)[nH]c2cc(I)ccc21 |
| InChI | InChI=1S/C13H17IN2S/c1-8(2)9(3)7-16-12-5-4-10(14)6-11(12)15-13(16)17/h4-6,8-9H,7H2,1-3H3,(H,15,17) |
| InChIKey | FRPCDPTUYWNAAD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|