C16H24N2S — CID 102906761
6-methyl-3-(3-methyl-2-propan-2-ylbutyl)-1H-benzimidazole-2-thione (PubChem CID 102906761) has the molecular formula C16H24N2S and a molecular weight of 276.45 g/mol. Its IUPAC name is 6-methyl-3-(3-methyl-2-propan-2-ylbutyl)-1H-benzimidazole-2-thione.
| Compound Name | 6-methyl-3-(3-methyl-2-propan-2-ylbutyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 102906761 |
| Molecular Formula | C16H24N2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 6-methyl-3-(3-methyl-2-propan-2-ylbutyl)-1H-benzimidazole-2-thione |
| SMILES | Cc1ccc2c(c1)[nH]c(=S)n2CC(C(C)C)C(C)C |
| InChI | InChI=1S/C16H24N2S/c1-10(2)13(11(3)4)9-18-15-7-6-12(5)8-14(15)17-16(18)19/h6-8,10-11,13H,9H2,1-5H3,(H,17,19) |
| InChIKey | BHNWUKJRTSNDJF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|