C16H22N2S — CID 79363094
6-methyl-3-[(2,2,3,3-tetramethylcyclopropyl)methyl]-1H-benzimidazole-2-thione (PubChem CID 79363094) has the molecular formula C16H22N2S and a molecular weight of 274.43 g/mol. Its IUPAC name is 6-methyl-3-[(2,2,3,3-tetramethylcyclopropyl)methyl]-1H-benzimidazole-2-thione.
| Compound Name | 6-methyl-3-[(2,2,3,3-tetramethylcyclopropyl)methyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 79363094 |
| Molecular Formula | C16H22N2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 6-methyl-3-[(2,2,3,3-tetramethylcyclopropyl)methyl]-1H-benzimidazole-2-thione |
| SMILES | Cc1ccc2c(c1)[nH]c(=S)n2CC1C(C)(C)C1(C)C |
| InChI | InChI=1S/C16H22N2S/c1-10-6-7-12-11(8-10)17-14(19)18(12)9-13-15(2,3)16(13,4)5/h6-8,13H,9H2,1-5H3,(H,17,19) |
| InChIKey | JXINAKRCTQMGIR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|