C16H21FN2S — CID 103592383
6-fluoro-5-methyl-3-[(2,2,3,3-tetramethylcyclopropyl)methyl]-1H-benzimidazole-2-thione (PubChem CID 103592383) has the molecular formula C16H21FN2S and a molecular weight of 292.42 g/mol. Its IUPAC name is 6-fluoro-5-methyl-3-[(2,2,3,3-tetramethylcyclopropyl)methyl]-1H-benzimidazole-2-thione.
| Compound Name | 6-fluoro-5-methyl-3-[(2,2,3,3-tetramethylcyclopropyl)methyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 103592383 |
| Molecular Formula | C16H21FN2S |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 6-fluoro-5-methyl-3-[(2,2,3,3-tetramethylcyclopropyl)methyl]-1H-benzimidazole-2-thione |
| SMILES | Cc1cc2c(cc1F)[nH]c(=S)n2CC1C(C)(C)C1(C)C |
| InChI | InChI=1S/C16H21FN2S/c1-9-6-12-11(7-10(9)17)18-14(20)19(12)8-13-15(2,3)16(13,4)5/h6-7,13H,8H2,1-5H3,(H,18,20) |
| InChIKey | NWEZVZWWOPTQBL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|