C13H14FN3OS — CID 103592338
5-[(5-fluoro-6-methyl-2-sulfanylidene-3H-benzimidazol-1-yl)methyl]pyrrolidin-2-one (PubChem CID 103592338) has the molecular formula C13H14FN3OS and a molecular weight of 279.34 g/mol. Its IUPAC name is 5-[(5-fluoro-6-methyl-2-sulfanylidene-3H-benzimidazol-1-yl)methyl]pyrrolidin-2-one.
| Compound Name | 5-[(5-fluoro-6-methyl-2-sulfanylidene-3H-benzimidazol-1-yl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 103592338 |
| Molecular Formula | C13H14FN3OS |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 5-[(5-fluoro-6-methyl-2-sulfanylidene-3H-benzimidazol-1-yl)methyl]pyrrolidin-2-one |
| SMILES | Cc1cc2c(cc1F)[nH]c(=S)n2CC1CCC(=O)N1 |
| InChI | InChI=1S/C13H14FN3OS/c1-7-4-11-10(5-9(7)14)16-13(19)17(11)6-8-2-3-12(18)15-8/h4-5,8H,2-3,6H2,1H3,(H,15,18)(H,16,19) |
| InChIKey | DDWBSDIXPZUSFK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|