C13H12FN3O2S — CID 103592373
3-(5-fluoro-6-methyl-2-sulfanylidene-3H-benzimidazol-1-yl)piperidine-2,6-dione (PubChem CID 103592373) has the molecular formula C13H12FN3O2S and a molecular weight of 293.32 g/mol. Its IUPAC name is 3-(5-fluoro-6-methyl-2-sulfanylidene-3H-benzimidazol-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(5-fluoro-6-methyl-2-sulfanylidene-3H-benzimidazol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 103592373 |
| Molecular Formula | C13H12FN3O2S |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 3-(5-fluoro-6-methyl-2-sulfanylidene-3H-benzimidazol-1-yl)piperidine-2,6-dione |
| SMILES | Cc1cc2c(cc1F)[nH]c(=S)n2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C13H12FN3O2S/c1-6-4-10-8(5-7(6)14)15-13(20)17(10)9-2-3-11(18)16-12(9)19/h4-5,9H,2-3H2,1H3,(H,15,20)(H,16,18,19) |
| InChIKey | SIXYGJHXQJGZIH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|