C14H13FN2O3 — CID 164846453
3-(1,1-dideuterio-6-fluoro-5-methyl-3-oxoisoindol-2-yl)piperidine-2,6-dione (PubChem CID 164846453) has the molecular formula C14H13FN2O3 and a molecular weight of 278.28 g/mol. Its IUPAC name is 3-(1,1-dideuterio-6-fluoro-5-methyl-3-oxoisoindol-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(1,1-dideuterio-6-fluoro-5-methyl-3-oxoisoindol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 164846453 |
| Molecular Formula | C14H13FN2O3 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 3-(1,1-dideuterio-6-fluoro-5-methyl-3-oxoisoindol-2-yl)piperidine-2,6-dione |
| SMILES | [2H]C1([2H])c2cc(F)c(C)cc2C(=O)N1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C14H13FN2O3/c1-7-4-9-8(5-10(7)15)6-17(14(9)20)11-2-3-12(18)16-13(11)19/h4-5,11H,2-3,6H2,1H3,(H,16,18,19)/i6D2 |
| InChIKey | MIBRMKCSTOGXOZ-NCYHJHSESA-N |
| XLogP | 0.90 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|