C18H20FN3O4 — CID 146300290
3-[6-[(1S,2S)-2-aminocyclopentyl]oxy-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 146300290) has the molecular formula C18H20FN3O4 and a molecular weight of 361.37 g/mol. Its IUPAC name is 3-[6-[(1S,2S)-2-aminocyclopentyl]oxy-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(1S,2S)-2-aminocyclopentyl]oxy-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146300290 |
| Molecular Formula | C18H20FN3O4 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 3-[6-[(1S,2S)-2-aminocyclopentyl]oxy-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | N[C@H]1CCC[C@@H]1Oc1cc2c(cc1F)C(=O)N(C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C18H20FN3O4/c19-11-7-10-9(6-15(11)26-14-3-1-2-12(14)20)8-22(18(10)25)13-4-5-16(23)21-17(13)24/h6-7,12-14H,1-5,8,20H2,(H,21,23,24)/t12-,13?,14-/m0/s1 |
| InChIKey | DZBRMBVCJBDJOV-HPNRGHHYSA-N |
| XLogP | 0.85 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|