C26H32FN3O4 — CID 166470129
3-[6-[(1S,2S)-2-(3-cyclobutylazetidin-1-yl)cyclohexyl]oxy-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166470129) has the molecular formula C26H32FN3O4 and a molecular weight of 469.56 g/mol. Its IUPAC name is 3-[6-[(1S,2S)-2-(3-cyclobutylazetidin-1-yl)cyclohexyl]oxy-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(1S,2S)-2-(3-cyclobutylazetidin-1-yl)cyclohexyl]oxy-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166470129 |
| Molecular Formula | C26H32FN3O4 |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 3-[6-[(1S,2S)-2-(3-cyclobutylazetidin-1-yl)cyclohexyl]oxy-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(O[C@H]4CCCC[C@@H]4N4CC(C5CCC5)C4)c(F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H32FN3O4/c27-19-11-18-16(14-30(26(18)33)21-8-9-24(31)28-25(21)32)10-23(19)34-22-7-2-1-6-20(22)29-12-17(13-29)15-4-3-5-15/h10-11,15,17,20-22H,1-9,12-14H2,(H,28,31,32)/t20-,21?,22-/m0/s1 |
| InChIKey | QRVWOIJJYGGDCG-NHNZYLEHSA-N |
| XLogP | 3.01 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|