C22H20FN3O5 — CID 170781368
[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl] N-(3-fluoro-4-methylphenyl)-N-methylcarbamate (PubChem CID 170781368) has the molecular formula C22H20FN3O5 and a molecular weight of 425.42 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl] N-(3-fluoro-4-methylphenyl)-N-methylcarbamate.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl] N-(3-fluoro-4-methylphenyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 170781368 |
| Molecular Formula | C22H20FN3O5 |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl] N-(3-fluoro-4-methylphenyl)-N-methylcarbamate |
| SMILES | Cc1ccc(N(C)C(=O)Oc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)cc1F |
| InChI | InChI=1S/C22H20FN3O5/c1-12-3-5-14(9-17(12)23)25(2)22(30)31-15-6-4-13-11-26(21(29)16(13)10-15)18-7-8-19(27)24-20(18)28/h3-6,9-10,18H,7-8,11H2,1-2H3,(H,24,27,28) |
| InChIKey | QWRYCZYTRAZGSS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|