C23H22ClN3O6 — CID 166074313
[2-(2,6-dioxopiperidin-3-yl)-7-methoxy-3-oxo-1H-isoindol-5-yl] N-(3-chloro-4-methylphenyl)-N-methylcarbamate (PubChem CID 166074313) has the molecular formula C23H22ClN3O6 and a molecular weight of 471.90 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-7-methoxy-3-oxo-1H-isoindol-5-yl] N-(3-chloro-4-methylphenyl)-N-methylcarbamate.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-7-methoxy-3-oxo-1H-isoindol-5-yl] N-(3-chloro-4-methylphenyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 166074313 |
| Molecular Formula | C23H22ClN3O6 |
| Molecular Weight | 471.90 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-7-methoxy-3-oxo-1H-isoindol-5-yl] N-(3-chloro-4-methylphenyl)-N-methylcarbamate |
| SMILES | COc1cc(OC(=O)N(C)c2ccc(C)c(Cl)c2)cc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C23H22ClN3O6/c1-12-4-5-13(8-17(12)24)26(2)23(31)33-14-9-15-16(19(10-14)32-3)11-27(22(15)30)18-6-7-20(28)25-21(18)29/h4-5,8-10,18H,6-7,11H2,1-3H3,(H,25,28,29) |
| InChIKey | QWBULFRDYPAYHV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.90 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|