C24H26N4O5 — CID 169322774
[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl] N-(2-tert-butyl-4-pyridinyl)-N-methylcarbamate (PubChem CID 169322774) has the molecular formula C24H26N4O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl] N-(2-tert-butyl-4-pyridinyl)-N-methylcarbamate.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl] N-(2-tert-butyl-4-pyridinyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 169322774 |
| Molecular Formula | C24H26N4O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl] N-(2-tert-butyl-4-pyridinyl)-N-methylcarbamate |
| SMILES | CN(C(=O)Oc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2)c1ccnc(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H26N4O5/c1-24(2,3)19-11-15(9-10-25-19)27(4)23(32)33-16-6-5-14-13-28(22(31)17(14)12-16)18-7-8-20(29)26-21(18)30/h5-6,9-12,18H,7-8,13H2,1-4H3,(H,26,29,30) |
| InChIKey | ZWIRJUOSYFEVKJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|