C26H21FN4O5 — CID 170781353
[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl] N-(2-fluoro-4-pyridin-2-ylphenyl)-N-methylcarbamate (PubChem CID 170781353) has the molecular formula C26H21FN4O5 and a molecular weight of 488.48 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl] N-(2-fluoro-4-pyridin-2-ylphenyl)-N-methylcarbamate.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl] N-(2-fluoro-4-pyridin-2-ylphenyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 170781353 |
| Molecular Formula | C26H21FN4O5 |
| Molecular Weight | 488.48 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl] N-(2-fluoro-4-pyridin-2-ylphenyl)-N-methylcarbamate |
| SMILES | CN(C(=O)Oc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2)c1ccc(-c2ccccn2)cc1F |
| InChI | InChI=1S/C26H21FN4O5/c1-30(21-8-6-15(12-19(21)27)20-4-2-3-11-28-20)26(35)36-17-7-5-16-14-31(25(34)18(16)13-17)22-9-10-23(32)29-24(22)33/h2-8,11-13,22H,9-10,14H2,1H3,(H,29,32,33) |
| InChIKey | LIXYLTBKYBXJAU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|