C30H37N3O3 — CID 176977763
ethane;3-(4-methyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;2-(4-methylphenyl)pyridine (PubChem CID 176977763) has the molecular formula C30H37N3O3 and a molecular weight of 487.64 g/mol. Its IUPAC name is ethane;3-(4-methyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;2-(4-methylphenyl)pyridine.
| Compound Name | ethane;3-(4-methyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;2-(4-methylphenyl)pyridine |
|---|---|
| PubChem CID | 176977763 |
| Molecular Formula | C30H37N3O3 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | ethane;3-(4-methyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;2-(4-methylphenyl)pyridine |
| SMILES | CC.CC.Cc1ccc(-c2ccccn2)cc1.Cc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C14H14N2O3.C12H11N.2C2H6/c1-8-3-2-4-9-7-16(14(19)12(8)9)10-5-6-11(17)15-13(10)18;1-10-5-7-11(8-6-10)12-4-2-3-9-13-12;2*1-2/h2-4,10H,5-7H2,1H3,(H,15,17,18);2-9H,1H3;2*1-2H3 |
| InChIKey | JRGCEXXJEMZLBF-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|