C20H20N4O4 — CID 166427130
3-[3-oxo-5-(6-propan-2-yloxypyrazin-2-yl)-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166427130) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 3-[3-oxo-5-(6-propan-2-yloxypyrazin-2-yl)-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-5-(6-propan-2-yloxypyrazin-2-yl)-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166427130 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 3-[3-oxo-5-(6-propan-2-yloxypyrazin-2-yl)-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC(C)Oc1cncc(-c2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)n1 |
| InChI | InChI=1S/C20H20N4O4/c1-11(2)28-18-9-21-8-15(22-18)12-3-4-13-10-24(20(27)14(13)7-12)16-5-6-17(25)23-19(16)26/h3-4,7-9,11,16H,5-6,10H2,1-2H3,(H,23,25,26) |
| InChIKey | QUWDKRHUIUSSSP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|