C21H22N4O4 — CID 167950106
3-[5-[6-[[(2S)-1-hydroxypropan-2-yl]amino]-3-pyridinyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167950106) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 3-[5-[6-[[(2S)-1-hydroxypropan-2-yl]amino]-3-pyridinyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[6-[[(2S)-1-hydroxypropan-2-yl]amino]-3-pyridinyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167950106 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 3-[5-[6-[[(2S)-1-hydroxypropan-2-yl]amino]-3-pyridinyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | C[C@@H](CO)Nc1ccc(-c2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)cn1 |
| InChI | InChI=1S/C21H22N4O4/c1-12(11-26)23-18-6-4-14(9-22-18)13-2-3-15-10-25(21(29)16(15)8-13)17-5-7-19(27)24-20(17)28/h2-4,6,8-9,12,17,26H,5,7,10-11H2,1H3,(H,22,23)(H,24,27,28)/t12-,17?/m0/s1 |
| InChIKey | LNVJOCIGFKADLP-WHUIICBVSA-N |
| XLogP | 1.30 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|