C15H15N5O4 — CID 170171290
3-[5-(azidomethyl)-7-methoxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 170171290) has the molecular formula C15H15N5O4 and a molecular weight of 329.32 g/mol. Its IUPAC name is 3-[5-(azidomethyl)-7-methoxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-(azidomethyl)-7-methoxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170171290 |
| Molecular Formula | C15H15N5O4 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 3-[5-(azidomethyl)-7-methoxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | COc1cc(CN=[N+]=[N-])cc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C15H15N5O4/c1-24-12-5-8(6-17-19-16)4-9-10(12)7-20(15(9)23)11-2-3-13(21)18-14(11)22/h4-5,11H,2-3,6-7H2,1H3,(H,18,21,22) |
| InChIKey | AIXIIHDHDCVSKF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 124.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|